Wikipedia:  

acetylated coumaric acid

acetylated coumaric acid; (E)-4-acetoxycinnamic acid
Molecular Formula
C11 H10 O4
Natural Isotopic Abundance Mass
206.1947
Mono-Isotopic Molecular Masses
C12N14:   206.0579088094
C13N14:   217.0948120252
C12N15:   206.0579088094
C13N15:   217.0948120252
acetylated coumaric acid image
acetylated coumaric acid
InCHi String:
InChI=1/C11H10O4/c1-8(12)15-10-5-2-9(3-6-10)4-7-11(13)14/h2-7H,1H3,(H,13,14)/b7-4+/f/h13H

Canonical and Isomeric SMILES:
SMILES_STRING


Beilstein
acetylated coumaric acid



PubChem Substance (SID):   111677957
PubChem Compound (CID):   n/a
KEGG: Compound ID   n/a
CAS Registry IDs:   n/a
PDB Chemical Component   n/a
NMR Lignin Database 129
Miscellaneous Databases and IDs:   n/a

Reference data were obtained primarily from the PubChem database.

Three dimensional molecular rendering uses Jmol.