Wikipedia:  

Acetylated ferulic acid

Acetylated ferulic acid; 4-acetoxy-3-methoxycinnamic acid
Molecular Formula
C12 H12 O5
Natural Isotopic Abundance Mass
236.22068
Mono-Isotopic Molecular Masses
C12N14:   236.0684734957
C13N14:   248.1087315493
C12N15:   236.0684734957
C13N15:   248.1087315493
Acetylated ferulic acid image
Acetylated ferulic acid
InCHi String:
InChI=1/C12H12O5/c1-8(13)17-10-5-3-9(4-6-12(14)15)7-11(10)16-2/h3-7H,1-2H3,(H,14,15)/b6-4+/f/h14H

Canonical and Isomeric SMILES:
CC(=O)OC1=C(C=C(C=C1)C=CC(O)=O)OC


Beilstein
Acetylated ferulic acid



PubChem Substance (SID):   111677942
PubChem Compound (CID):   n/a
KEGG: Compound ID   n/a
CAS Registry IDs:   n/a
PDB Chemical Component   n/a
NMR Lignin Database 108
Miscellaneous Databases and IDs:   n/a

Reference data were obtained primarily from the PubChem database.

Three dimensional molecular rendering uses Jmol.