InCHi String:
InChI=1S/C5H12O5/c6-1-3(8)5(10)4(9)2-7/h3-10H,1-2H2/t3-,4+,5?
isomeric SMILES: C([C@@H](C([C@@H](CO)O)O)O)O
canonical SMILES: C(C(C(C(CO)O)O)O)O
IUPAC(2S,4R)-pentane-1,2,3,4,5-pentol
IUPAC traditional: IUPAC cas: IUPAC openeye: IUPAC systematicpentane-1,2,3,4,5-pentol
PubChem Substance (SID):
111677726 149920 3669PubChem Compound (CID):
6912KEGG: Compound ID
C00379CAS Registry IDs: 12426-00-5 37191-59-6 7313-55-5 75398-81-1 84709-42-2 87-99-0
PDB Chemical Component
XYLMiscellaneous Databases and IDs:
CHEBI 17151 EINECS 201-788-0
NSC 25283
Beilstein Handbook Reference 4-01-00-02832
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
