InCHi String:
InChI=1S/C5H4N4O2/c10-4-2-3(7-1-6-2)8-5(11)9-4/h1H,(H3,6,7,8,9,10,11)
isomeric and canonical SMILES: C1=NC2=C(N1)C(=O)NC(=O)N2
IUPAC: IUPAC cas: IUPAC openeye: IUPAC systematic3,7-dihydropurine-2,6-dione
IUPAC traditional3,7-dihydropurine-2,6-quinone
PubChem Substance (SID):
85164959 149179 3675PubChem Compound (CID):
1188KEGG: Compound ID
C00385CAS Registry IDs: 16819-86-6 28522-58-9 33669-67-9 42911-15-9 6050-36-8 6053-41-4 69-89-6
PDB Chemical Component
XANMiscellaneous Databases and IDs:
CHEBI 17712 EINECS 200-718-6
CCRIS 994
NSC 14664
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.