InCHi String:
InChI=1S/C4H4N2O2/c7-3-1-2-5-4(8)6-3/h1-2H,(H2,5,6,7,8)
isomeric and canonical SMILES: C1=CNC(=O)NC1=O
IUPAC1H-pyrimidine-2,4-dione
IUPAC traditional1H-pyrimidine-2,4-quinone
IUPAC cas: IUPAC openeye: IUPAC systematicpyrimidine-2,4-diol
PubChem Substance (SID):
85165007 149089 3406PubChem Compound (CID):
1174KEGG: Compound ID
C00106CAS Registry IDs: 144104-68-7 42910-77-0 4433-21-0 4433-24-3 66-22-8 766-19-8
PDB Chemical Component
URAMiscellaneous Databases and IDs:
CHEBI 17568 NSC 3970
EINECS 200-621-9
CCRIS 3077
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.