InCHi String:
InChI=1S/C10H12N2/c11-6-5-8-7-12-10-4-2-1-3-9(8)10/h1-4,7,12H,5-6,11H2
isomeric and canonical SMILES: C1=CC=C2C(=C1)C(=CN2)CCN
IUPAC: IUPAC traditional: IUPAC cas: IUPAC openeye: IUPAC systematic2-(1H-indol-3-yl)ethanamine
PubChem Substance (SID):
85165023 148980 3688PubChem Compound (CID):
1150KEGG: Compound ID
C00398CAS Registry IDs: 343-94-2 34685-69-3 61-54-1
PDB Chemical Component
TSSMiscellaneous Databases and IDs:
CHEBI 16765 EINECS 200-510-5
Beilstein Handbook Reference 5-22-10-00045
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
