InCHi String:
InChI=1S/C3H9N/c1-4(2)3/h1-3H3
isomeric and canonical SMILES: CN(C)C
IUPACN,N-dimethylmethanamine
PubChem Substance (SID):
85165035 149321 3844PubChem Compound (CID):
1146KEGG: Compound ID
C00565CAS Registry IDs: 20230-89-1 2840-24-6 4558-12-7 593-81-7 75-50-3
PDB Chemical Component
KENMiscellaneous Databases and IDs:
CHEBI 18139 HSDB 808
CCRIS 6283
EINECS 200-875-0
FEMA No. 3241
FEMA Number 3241
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.