InCHi String:
InChI=1S/C9H8O2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7H,(H,10,11)/b7-6+
isomeric SMILES: C1=CC=C(C=C1)\C=C\C(=O)O
canonical SMILES: C1=CC=C(C=C1)C=CC(=O)O
IUPAC(E)-3-phenylprop-2-enoic acid
IUPAC traditional: IUPAC cas: IUPAC openeyecinnamic acid
PubChem Substance (SID):
85164956 3713PubChem Compound (CID):
444539KEGG: Compound ID
C00423CAS Registry IDs: 140-10-3
PDB Chemical Component
TCAMiscellaneous Databases and IDs:
CHEBI 15669
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
