InCHi String:
InChI=1S/C5H9NO3/c7-3-1-4(5(8)9)6-2-3/h3-4,6-7H,1-2H2,(H,8,9)/t3-,4+/m1/s1
isomeric SMILES: C1[C@H](CN[C@@H]1C(=O)O)O
canonical SMILES: C1C(CNC1C(=O)O)O
IUPAC: IUPAC traditional: IUPAC cas: IUPAC openeye: IUPAC systematic(2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid
PubChem Substance (SID):
85164955 148602 4260PubChem Compound (CID):
5810KEGG: Compound ID
C01015CAS Registry IDs: 138-46-5 17210-41-2 21105-75-9 24784-87-0 51-35-4 54733-36-7
PDB Chemical Component
HYPMiscellaneous Databases and IDs:
CHEBI 18240 NSC 46704
EINECS 200-091-9
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.