InCHi String:
InChI=1S/C9H8O3/c10-8-3-1-2-7(6-8)4-5-9(11)12/h1-6,10H,(H,11,12)/b5-4+
isomeric SMILES: C1=CC(=CC(=C1)O)\C=C\C(=O)O
canonical SMILES: C1=CC(=CC(=C1)O)C=CC(=O)O
IUPAC: IUPAC cas: IUPAC openeye: IUPAC systematic(E)-3-(3-hydroxyphenyl)prop-2-enoic acid
IUPAC traditional(E)-3-(3-hydroxyphenyl)acrylic acid
PubChem Substance (SID):
85164933 583011PubChem Compound (CID):
637541KEGG: Compound ID
C12621CAS Registry IDs: 588-30-7
PDB Chemical Component n/a
Miscellaneous Databases and IDs: n/a
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.