InCHi String:
InChI=1S/C9H8O3/c10-8-4-2-1-3-7(8)5-6-9(11)12/h1-6,10H,(H,11,12)/b6-5+
canonical SMILES: C1=CC=C(C(=C1)C=CC(=O)O)O
isomeric SMILES: C1=CC=C(C(=C1)\C=C\C(=O)O)O
PUBCHEM iupac NAME: PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac CAS NAME: PUBCHEM iupac SYSTEMATIC NAME(E)-3-(2-hydroxyphenyl)prop-2-enoic acid
PUBCHEM iupac TRADITIONAL NAME(E)-3-(2-hydroxyphenyl)acrylic acid
PubChem Substance (SID):
85165146 7986811 4905PubChem Compound (CID):
637540KEGG: Compound ID
C03549CAS Registry IDs: 583-17-5 614-60-8
PDB Chemical Component
2HCMiscellaneous Databases and IDs:
Sigma-Aldrich 28170_FLUKA
ChEBI CHEBI:18125 ChemSpider 553146
NMRShiftDB 10008842
CambridgeSoft Corporation 1901
NIST Chemistry WebBook 547074069
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.