InCHi String:
InChI=1S/C2Cl4/c3-1(4)2(5)6
canonical and isomeric SMILES: C(=C(Cl)Cl)(Cl)Cl
PUBCHEM iupac NAME: PUBCHEM iupac SYSTEMATIC NAME1,1,2,2-tetrachloroethene
PUBCHEM iupac TRADITIONAL NAME: PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac CAS NAME1,1,2,2-tetrachloroethylene
PubChem Substance (SID):
111677775 24863125 75150PubChem Compound (CID):
31373KEGG: Compound ID
C06789CAS Registry IDs: 127-18-4
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
Sigma-Aldrich 371696_ALDRICH
DTP/NCI 9777
MMCD cq_03932
MDL MFCD00000834
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.