InCHi String:
InChI=1S/C9H10O5/c1-13-6-3-5(9(11)12)4-7(14-2)8(6)10/h3-4,10H,1-2H3,(H,11,12)
canonical and isomeric SMILES: COC1=CC(=CC(=C1O)OC)C(=O)O
PUBCHEM iupac NAME: PUBCHEM iupac CAS NAME4-hydroxy-3,5-dimethoxybenzoic acid
PUBCHEM iupac TRADITIONAL NAME: PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac SYSTEMATIC NAME4-hydroxy-3,5-dimethoxy-benzoic acid
PubChem Substance (SID):
85165375 48035435 154045PubChem Compound (CID):
10742KEGG: Compound ID
C10833CAS Registry IDs: 530-57-4 64887-60-1
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
ChemIDplus 000530574
EINECS 208-486-8
NMRShiftDB 20040774
Beilstein Handbook Reference 4-10-00-01995
ChemDB 4260176
NIST Chemistry WebBook 2520291272
MMCD cq_07498
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.