InCHi String:
InChI=1S/C11H12O5/c1-15-8-5-7(3-4-10(12)13)6-9(16-2)11(8)14/h3-6,14H,1-2H3,(H,12,13)/b4-3+
canonical SMILES: COC1=CC(=CC(=C1O)OC)C=CC(=O)O
isomeric SMILES: COC1=CC(=CC(=C1O)OC)/C=C/C(=O)O
PUBCHEM iupac NAME(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoic acid
PUBCHEM iupac TRADITIONAL NAME(E)-3-(4-hydroxy-3,5-dimethoxy-phenyl)acrylic acid
PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac SYSTEMATIC NAME(E)-3-(4-hydroxy-3,5-dimethoxy-phenyl)prop-2-enoic acid
PUBCHEM iupac CAS NAME(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)-2-propenoic acid
PubChem Substance (SID):
111677751 7890641 3765PubChem Compound (CID):
637775KEGG: Compound ID
C00482CAS Registry IDs: 530-59-6
PDB Chemical Component
SXXMiscellaneous Databases and IDs:
ChEBI CHEBI:15714 ZINC ZINC00153654
SMID SXX
ChemSpider 553361
NMRShiftDB 20035521
NIST Chemistry WebBook 351825418
MMCD cq_00339
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.