InCHi String:
InChI=1S/C11H12O5/c1-15-8-5-7(3-4-10(12)13)6-9(16-2)11(8)14/h3-6,14H,1-2H3,(H,12,13)/b4-3+
canonical SMILES: COC1=CC(=CC(=C1O)OC)C=CC(=O)O
isomeric SMILES: COC1=CC(=CC(=C1O)OC)\C=C\C(=O)O
PUBCHEM iupac NAME: PUBCHEM iupac CAS NAME(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoic acid
PUBCHEM iupac TRADITIONAL NAME(E)-3-(4-hydroxy-3,5-dimethoxy-phenyl)acrylic acid
PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac SYSTEMATIC NAME(E)-3-(4-hydroxy-3,5-dimethoxy-phenyl)prop-2-enoic acid
PubChem Substance (SID):
111677739 610823 10455954PubChem Compound (CID):
637775KEGG: Compound ID
C00482CAS Registry IDs: 530-59-6 7362-37-0
PDB Chemical Component
SXXMiscellaneous Databases and IDs:
Thomson Pharma 00059070
ChemIDplus 007362370
Ambinter STOCK1N-17013
ChEBI CHEBI:15714 NIST 351825418
DiscoveryGate 637775
DTP/NCI 59261
Sigma-Aldrich 85429_FLUKA
NIAID 024970
MMDB 51888.21
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.