InCHi String:
InChI=1S/C11H12O4/c1-14-9-6-8(4-3-5-12)7-10(15-2)11(9)13/h3-7,13H,1-2H3/b4-3+
canonical SMILES: COC1=CC(=CC(=C1O)OC)C=CC=O
isomeric SMILES: COC1=CC(=CC(=C1O)OC)/C=C/C=O
PUBCHEM iupac NAME(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enal
PUBCHEM iupac TRADITIONAL NAME(E)-3-(4-hydroxy-3,5-dimethoxy-phenyl)acrolein
PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac SYSTEMATIC NAME(E)-3-(4-hydroxy-3,5-dimethoxy-phenyl)prop-2-enal
PUBCHEM iupac CAS NAME(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)-2-propenal
PubChem Substance (SID):
85165374 10537235 39289825PubChem Compound (CID):
5280802KEGG: Compound ID
C05610CAS Registry IDs: 4206-58-0
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
ChEBI CHEBI:27949 ChemSpider 4444359
NIST Chemistry WebBook 647569892
MMCD cq_03148
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.