InCHi String:
InChI=1S/C7H10O5/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1,4-6,8-10H,2H2,(H,11,12)/t4-,5-,6-/m1/s1
isomeric SMILES: C1[C@H]([C@@H]([C@@H](C=C1C(=O)O)O)O)O
canonical SMILES: C1C(C(C(C=C1C(=O)O)O)O)O
IUPAC(3R,4S,5R)-3,4,5-trihydroxycyclohexene-1-carboxylic acid
PubChem Substance (SID):
85164949 151900 3776PubChem Compound (CID):
8742KEGG: Compound ID
C00493CAS Registry IDs: 138-59-0
PDB Chemical Component
SKMMiscellaneous Databases and IDs:
CHEBI 16119 EINECS 205-334-2
CCRIS 7681
HSDB 3537
NSC 59257
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.