InCHi String:
InChI=1S/C6H12O6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-12H
isomeric and canonical SMILES: C1(C(C(C(C(C1O)O)O)O)O)O
IUPAC: IUPAC traditional: IUPAC cas: IUPAC openeye: IUPAC systematiccyclohexane-1,2,3,4,5,6-hexol
PubChem Substance (SID):
111677724 669687 8409PubChem Compound (CID):
892KEGG: Compound ID
C06153CAS Registry IDs: 488-59-5
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
CHEBI 10642 ChemIDplus 000488595
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
