InCHi String:
InChI=1S/C10H14O2/c1-7(2)8-3-5-9(6-4-8)10(11)12/h5,8H,1,3-4,6H2,2H3,(H,11,12)/t8-/m1/s1
canonical SMILES: CC(=C)C1CCC(=CC1)C(=O)O
isomeric SMILES: CC(=C)[C@H]1CCC(=CC1)C(=O)O
PUBCHEM iupac NAME: PUBCHEM iupac SYSTEMATIC NAME(4S)-4-prop-1-en-2-ylcyclohexene-1-carboxylic acid
PUBCHEM iupac TRADITIONAL NAME: PUBCHEM iupac OPENEYE NAME(4S)-4-isopropenylcyclohexene-1-carboxylic acid
PUBCHEM iupac CAS NAME(4S)-4-isopropenyl-1-cyclohexenecarboxylic acid
PubChem Substance (SID):
111677835 11111656 57260178PubChem Compound (CID):
2724160KEGG: Compound ID n/a
CAS Registry IDs: n/a
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
Sigma-Aldrich 218359_ALDRICH
MLSMR MLS002153221
ChemSpider 2006319
NCGC NCGC00015832-01
MMCD cq_08498
MDL MFCD00062539
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.