InCHi String:
InChI=1S/C10H14O/c1-8(2)10-5-3-9(7-11)4-6-10/h3,7,10H,1,4-6H2,2H3/t10-/m1/s1
canonical SMILES: CC(=C)C1CCC(=CC1)C=O
isomeric SMILES: CC(=C)[C@H]1CCC(=CC1)C=O
PUBCHEM iupac NAME: PUBCHEM iupac SYSTEMATIC NAME(4S)-4-prop-1-en-2-ylcyclohexene-1-carbaldehyde
PUBCHEM iupac TRADITIONAL NAME: PUBCHEM iupac OPENEYE NAME(4S)-4-isopropenylcyclohexene-1-carbaldehyde
PUBCHEM iupac CAS NAME(4S)-4-isopropenyl-1-cyclohexenecarboxaldehyde
PubChem Substance (SID):
111677777 8004060 30082395PubChem Compound (CID):
2724159KEGG: Compound ID n/a
CAS Registry IDs: 18031-40-8
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
Sigma-Aldrich 218294_ALDRICH
ChemSpider 2006318
NMRShiftDB 20055163
ZINC ZINC01529472
MMCD cq_01583
MDL MFCD00001543
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
