InCHi String:
InChI=1S/C7H5NO4/c9-6(10)4-2-1-3-8-5(4)7(11)12/h1-3H,(H,9,10)(H,11,12)
isomeric and canonical SMILES: C1=CC(=C(N=C1)C(=O)O)C(=O)O
IUPAC: IUPAC traditional: IUPAC cas: IUPAC openeye: IUPAC systematicpyridine-2,3-dicarboxylic acid
PubChem Substance (SID):
85165030 149970 6487PubChem Compound (CID):
1066KEGG: Compound ID
C03722CAS Registry IDs: 18970-62-2 87314-99-6 89-00-9
PDB Chemical Component
NTMMiscellaneous Databases and IDs:
CHEBI 16675 EINECS 201-874-8
NSC 13127
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
