InCHi String:
InChI=1S/C8H13N2O5P/c1-5-8(11)7(2-9)6(3-10-5)4-15-16(12,13)14/h3,11H,2,4,9H2,1H3,(H2,12,13,14)
isomeric and canonical SMILES: CC1=NC=C(C(=C1O)CN)COP(=O)(O)O
IUPAC: IUPAC systematic[4-(aminomethyl)-5-hydroxy-6-methyl-pyridin-3-yl]methoxyphosphonic acid
IUPAC traditional: IUPAC cas: IUPAC openeye[4-(aminomethyl)-5-hydroxy-6-methyl-3-pyridyl]methoxyphosphonic acid
PubChem Substance (SID):
85164962 154034 3919PubChem Compound (CID):
1053KEGG: Compound ID
C00647CAS Registry IDs: 529-96-4 951-83-7
PDB Chemical Component
PMPMiscellaneous Databases and IDs:
CHEBI 18335 EINECS 208-471-6
Beilstein Handbook Reference 4-22-00-06065
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.