InCHi String:
InChI=1S/C10H16O/c1-6-8-4-7(5-9(6)11)10(8,2)3/h7-9,11H,1,4-5H2,2-3H3/t7?,8?,9-/m1/s1
canonical SMILES: CC1(C2CC1C(=C)C(C2)O)C
isomeric SMILES: CC1(C2CC1C(=C)[C@@H](C2)O)C
PUBCHEM iupac NAME(3R)-7,7-dimethyl-4-methylidenebicyclo[3.1.1]heptan-3-ol
PUBCHEM iupac TRADITIONAL NAME: PUBCHEM iupac OPENEYE NAME(3R)-6,6-dimethyl-2-methylene-norpinan-3-ol
PUBCHEM iupac CAS NAME(3R)-6,6-dimethyl-2-methylene-3-norpinanol
PUBCHEM iupac SYSTEMATIC NAME(3R)-7,7-dimethyl-4-methylidene-bicyclo[3.1.1]heptan-3-ol
PubChem Substance (SID):
85165341 24887566PubChem Compound (CID):
12314318KEGG: Compound ID n/a
CAS Registry IDs: n/a
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
Sigma-Aldrich 80613_FLUKA
MMCD cq_08515
MDL MFCD00210086
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.