InCHi String:
InChI=1S/C10H11NO3/c12-9(11-7-10(13)14)6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,11,12)(H,13,14)
canonical and isomeric SMILES: C1=CC=C(C=C1)CC(=O)NCC(=O)O
PUBCHEM iupac NAME: PUBCHEM iupac TRADITIONAL NAME: PUBCHEM iupac OPENEYE NAME2-[(2-phenylacetyl)amino]acetic acid
PUBCHEM iupac CAS NAME2-[(1-oxo-2-phenylethyl)amino]acetic acid
PUBCHEM iupac SYSTEMATIC NAME2-(2-phenylethanoylamino)ethanoic acid
PubChem Substance (SID):
111677796 7922 10374072PubChem Compound (CID):
68144KEGG: Compound ID
C05598CAS Registry IDs: 500-98-1
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
DTP/NCI 408424
NIST 211889612
MMCD cq_03140
MDL MFCD00021744
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
