InCHi String:
InChI=1S/C8H8O2/c9-8(10)6-7-4-2-1-3-5-7/h1-5H,6H2,(H,9,10)
isomeric and canonical SMILES: C1=CC=C(C=C1)CC(=O)O
IUPAC: IUPAC traditional: IUPAC cas: IUPAC openeye2-phenylacetic acid
IUPAC systematic2-phenylethanoic acid
PubChem Substance (SID):
85165031 150763 9297PubChem Compound (CID):
999KEGG: Compound ID
C07086CAS Registry IDs: 103-82-2 114-70-5 13005-36-2 52009-49-1 7188-16-1
PDB Chemical Component
PACMiscellaneous Databases and IDs:
CHEBI 30745 EINECS 203-148-6
HSDB 5010
NSC 125718
FEMA No. 2878
Beilstein Handbook Reference 4-09-00-01614
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
