InCHi String:
InChI=1S/C10H16O/c1-8(2)10-5-3-9(7-11)4-6-10/h3,10-11H,1,4-7H2,2H3/t10-/m1/s1
canonical SMILES: CC(=C)C1CCC(=CC1)CO
isomeric SMILES: CC(=C)[C@H]1CCC(=CC1)CO
PUBCHEM iupac NAME: PUBCHEM iupac SYSTEMATIC NAME[(4S)-4-prop-1-en-2-yl-1-cyclohexenyl]methanol
PUBCHEM iupac TRADITIONAL NAME: PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac CAS NAME[(4S)-4-isopropenyl-1-cyclohexenyl]methanol
PubChem Substance (SID):
85165339 24701625 24887186PubChem Compound (CID):
369312KEGG: Compound ID
C02452CAS Registry IDs: 536-59-4 18457-55-1
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
Sigma-Aldrich 77311_FLUKA
ChEBI CHEBI:10782 ChemBank NCI60_013758
ChemSpider 327861
NMRShiftDB 20055161
DTP/NCI 641066
LipidMAPS LMPR01020028
ZINC ZINC03861538
MMCD cq_01514
MDL MFCD00062995
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
