InCHi String:
InChI=1S/C9H8O3/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6,10H,(H,11,12)/b6-3+
canonical SMILES: C1=CC(=CC=C1C=CC(=O)O)O
isomeric SMILES: C1=CC(=CC=C1/C=C/C(=O)O)O
PUBCHEM iupac NAME: PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac SYSTEMATIC NAME(E)-3-(4-hydroxyphenyl)prop-2-enoic acid
PUBCHEM iupac TRADITIONAL NAME(E)-3-(4-hydroxyphenyl)acrylic acid
PUBCHEM iupac CAS NAME(E)-3-(4-hydroxyphenyl)-2-propenoic acid
PubChem Substance (SID):
111677750 10534360 24893127PubChem Compound (CID):
637542KEGG: Compound ID
C00811CAS Registry IDs: 7400-08-0 501-98-4
PDB Chemical Component
HC4Miscellaneous Databases and IDs:
Sigma-Aldrich C9008_SIGMA
ChEBI CHEBI:32374 DrugBank DB04066
ChemSpider 13884182
NMRShiftDB 10018811
NIST Chemistry WebBook 1624948018
MMCD cq_00551
MDL MFCD00004399
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.