InCHi String:
InChI=1/C10H12O2/c1-12-10-6-4-9(5-7-10)3-2-8-11/h2-7,11H,8H2,1H3/b3-2+
Canonical and Isomeric SMILES: COC1=CC=C(C=CCO)C=C1
Beilsteinp-Methoxy coumaryl alcohol
PubChem Substance (SID):
111678014PubChem Compound (CID): n/a
KEGG: Compound ID n/a
CAS Registry IDs: n/a
PDB Chemical Component n/a
NMR Lignin Database 219
Miscellaneous Databases and IDs: n/a
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
