InCHi String:
InChI=1S/C7H8O2/c8-5-6-1-3-7(9)4-2-6/h1-4,8-9H,5H2
Canonical and Isomeric SMILES: C1=C(C=CC(=C1)O)CO
Beilsteinp-Hydroxybenzyl alcohol
PubChem Substance (SID):
111677929PubChem Compound (CID): n/a
KEGG: Compound ID n/a
CAS Registry IDs: n/a
PDB Chemical Component n/a
NMR Lignin Database 4
Miscellaneous Databases and IDs: n/a
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
