InCHi String:
InChI=1S/C10H14N2/c1-12-7-3-5-10(12)9-4-2-6-11-8-9/h2,4,6,8,10H,3,5,7H2,1H3/t10-/m0/s1
isomeric SMILES: CN1CCC[14C@H]1C2=CN=CC=C2
canonical SMILES: CN1CCCC1C2=CN=CC=C2
IUPAC: IUPAC traditional: IUPAC cas: IUPAC openeye: IUPAC systematic3-[(2S)-1-methylpyrrolidin-2-yl]pyridine
PubChem Substance (SID):
85164941 752807 4007PubChem Compound (CID):
175605KEGG: Compound ID
C00745CAS Registry IDs: 94292-33-8
PDB Chemical Component
NCTMiscellaneous Databases and IDs:
CHEBI 17688
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
