InCHi String:
InChI=1S/C6H5NO2/c8-6(9)5-2-1-3-7-4-5/h1-4H,(H,8,9)
isomeric and canonical SMILES: C1=CC(=CN=C1)C(=O)O
IUPAC: IUPAC systematicpyridine-3-carboxylic acid
IUPAC traditional: IUPAC cas: IUPAC openeyenicotinic acid
PubChem Substance (SID):
85164940 148918 3552PubChem Compound (CID):
938KEGG: Compound ID
C00253CAS Registry IDs: 10361-13-4 123574-58-3 16518-17-5 1976-28-9 28029-53-0 28029-54-1 36321-41-2 3789-96-6 53890-72-5 54-86-4 59-67-6 636-79-3 7069-06-9 823-77-8 99148-57-9
PDB Chemical Component
NIOMiscellaneous Databases and IDs:
CHEBI 15940 Beilstein Handbook Reference 5-22-02-00057
NSC 169454
EINECS 200-441-0
CCRIS 1902
HSDB 3134
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
