InCHi String:
InChI=1S/C12H19N2O2/c1-13(2)12(15)16-11-8-6-7-10(9-11)14(3,4)5/h6-9H,1-5H3/q+1
canonical and isomeric SMILES: CN(C)C(=O)OC1=CC=CC(=C1)[N+](C)(C)C
PUBCHEM iupac NAME[3-(dimethylcarbamoyloxy)phenyl]-trimethylazanium
PUBCHEM iupac TRADITIONAL NAME: PUBCHEM iupac OPENEYE NAME[3-(dimethylcarbamoyloxy)phenyl]-trimethyl-ammonium
PUBCHEM iupac CAS NAME[3-[dimethylamino(oxo)methoxy]phenyl]-trimethylammonium
PUBCHEM iupac SYSTEMATIC NAME[3-(dimethylcarbamoyloxy)phenyl]-trimethyl-azanium
PubChem Substance (SID):
111677888 9467 93165415PubChem Compound (CID):
4456KEGG: Compound ID
C07258CAS Registry IDs: 59-99-4 51-60-5
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
ChEBI CHEBI:7514 EPA DSSTox 23360
ChemSpider 4301
ChemBank KBioGR_000623
NMRShiftDB 20200212
ZINC ZINC00001792
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
