InCHi String:
InChI=1S/C10H20O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-11H,4-6H2,1-3H3/t8-,9+,10+/m1/s1
canonical SMILES: CC1CCC(C(C1)O)C(C)C
isomeric SMILES: C[C@@H]1CC[C@H]([C@H](C1)O)C(C)C
PUBCHEM iupac NAME(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexan-1-ol
PUBCHEM iupac TRADITIONAL NAME: PUBCHEM iupac OPENEYE NAME(1S,2S,5R)-2-isopropyl-5-methyl-cyclohexan-1-ol
PUBCHEM iupac CAS NAME(1S,2S,5R)-2-isopropyl-5-methyl-1-cyclohexanol
PUBCHEM iupac SYSTEMATIC NAME(1S,2S,5R)-5-methyl-2-propan-2-yl-cyclohexan-1-ol
PubChem Substance (SID):
85165280 36883511 24886260PubChem Compound (CID):
439263KEGG: Compound ID
C00553CAS Registry IDs: 89-78-1 15356-60-2
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
Sigma-Aldrich 72134_FLUKA
ChEBI CHEBI:15402 LipidMAPS LMPR01020017
ChemSpider 388397
NMRShiftDB 10008950
MMCD cq_00395
MDL MFCD00062980
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.