InCHi String:
InChI=1S/C6H12O6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-12H/t1-,2-,3-,4+,5-,6-
isomeric and canonical SMILES: C1(C(C(C(C(C1O)O)O)O)O)O
IUPAC: IUPAC traditional: IUPAC cas: IUPAC openeye: IUPAC systematiccyclohexane-1,2,3,4,5,6-hexol
PubChem Substance (SID):
111677723 149916 3437PubChem Compound (CID):
892KEGG: Compound ID
C00137CAS Registry IDs: 53319-35-0 87-89-8
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
CHEBI 17268 CCRIS 6745
NSC 404118
EINECS 201-781-2
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.