InCHi String:
InChI=1S/C6H12O6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-12H/t1-,2-,3-,4+,5+,6+
isomeric and canonical SMILES: C1(C(C(C(C(C1O)O)O)O)O)O
IUPAC: IUPAC traditional: IUPAC cas: IUPAC openeye: IUPAC systematiccyclohexane-1,2,3,4,5,6-hexol
PubChem Substance (SID):
111677722 675808 8408PubChem Compound (CID):
892KEGG: Compound ID
C06152CAS Registry IDs: 488-55-1
PDB Chemical Component
CBUMiscellaneous Databases and IDs:
EINECS 207-681-5
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
