InCHi String:
InChI=1S/C5H8O4/c1-2-9-5(8)3-4(6)7/h2-3H2,1H3,(H,6,7)
canonical and isomeric SMILES: CCOC(=O)CC(=O)O
PUBCHEM iupac NAME: PUBCHEM iupac CAS NAME3-ethoxy-3-oxopropanoic acid
PUBCHEM iupac TRADITIONAL NAME3-ethoxy-3-keto-propionic acid
PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac SYSTEMATIC NAME3-ethoxy-3-oxo-propanoic acid
PubChem Substance (SID):
85165358 212794 24868159PubChem Compound (CID):
70615KEGG: Compound ID n/a
CAS Registry IDs: 1071-46-1
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
Sigma-Aldrich 445088_ALDRICH
ChemIDplus 001071461
EINECS 213-992-7
ChemDB 6047117
MMCD cq_10695
MDL MFCD00020490
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
