InCHi String:
InChI=1S/C12H14O5/c1-15-9-6-8(4-5-11(13)17-3)7-10(16-2)12(9)14/h4-7,14H,1-3H3/b5-4+
canonical SMILES: COC1=CC(=CC(=C1O)OC)C=CC(=O)OC
isomeric SMILES: COC1=CC(=CC(=C1O)OC)/C=C/C(=O)OC
PUBCHEM iupac NAMEmethyl (E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoate
PUBCHEM iupac TRADITIONAL NAME(E)-3-(4-hydroxy-3,5-dimethoxy-phenyl)acrylic acid methyl ester
PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac SYSTEMATIC NAMEmethyl (E)-3-(4-hydroxy-3,5-dimethoxy-phenyl)prop-2-enoate
PUBCHEM iupac CAS NAME(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)-2-propenoic acid methyl ester
PubChem Substance (SID):
85165364 737352 39294577PubChem Compound (CID):
5321318KEGG: Compound ID n/a
CAS Registry IDs: 20733-94-2
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
ChemIDplus 020733942
ChemSpider 4479104
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.