InCHi String:
InChI=1S/C5H8O3/c1-3(2)4(6)5(7)8/h3H,1-2H3,(H,7,8)
isomeric and canonical SMILES: CC(C)C(=O)C(=O)O
IUPAC: IUPAC traditional: IUPAC cas: IUPAC openeye: IUPAC systematic3-methyl-2-oxo-butanoic acid
PubChem Substance (SID):
85164939 207009 3441PubChem Compound (CID):
49KEGG: Compound ID
C00141CAS Registry IDs: 3715-29-5 51828-94-5 759-05-7
PDB Chemical Component
KIVMiscellaneous Databases and IDs:
CHEBI 16530 EINECS 212-065-4
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.