InCHi String:
InChI=1S/C13H20O3/c1-3-4-5-6-11-10(7-8-12(11)14)9-13(15)16-2/h4-5,10-11H,3,6-9H2,1-2H3
canonical and isomeric SMILES: CCC=CCC1C(CCC1=O)CC(=O)OC
PUBCHEM iupac NAMEmethyl 2-(3-oxo-2-pent-2-enylcyclopentyl)acetate
PUBCHEM iupac TRADITIONAL NAME2-(3-keto-2-pent-2-enyl-cyclopentyl)acetic acid methyl ester
PUBCHEM iupac OPENEYE NAMEmethyl 2-(3-oxo-2-pent-2-enyl-cyclopentyl)acetate
PUBCHEM iupac CAS NAME2-(3-oxo-2-pent-2-enylcyclopentyl)acetic acid methyl ester
PUBCHEM iupac SYSTEMATIC NAMEmethyl 2-(3-oxo-2-pent-2-enyl-cyclopentyl)ethanoate
PubChem Substance (SID):
85165331 24864478 4551186PubChem Compound (CID):
62388KEGG: Compound ID n/a
CAS Registry IDs: n/a
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
Sigma-Aldrich 392707_ALDRICH
ChemSpider 56176
ChemDB 4259934
MMCD cq_08134
MDL MFCD00151382
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.