InCHi String:
InChI=1S/C11H12O4/c1-14-10-7-8(3-5-9(10)12)4-6-11(13)15-2/h3-7,12H,1-2H3/b6-4+
canonical SMILES: COC1=C(C=CC(=C1)C=CC(=O)OC)O
isomeric SMILES: COC1=C(C=CC(=C1)/C=C/C(=O)OC)O
PUBCHEM iupac NAMEmethyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate
PUBCHEM iupac TRADITIONAL NAME(E)-3-(4-hydroxy-3-methoxy-phenyl)acrylic acid methyl ester
PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac SYSTEMATIC NAMEmethyl (E)-3-(4-hydroxy-3-methoxy-phenyl)prop-2-enoate
PUBCHEM iupac CAS NAME(E)-3-(4-hydroxy-3-methoxyphenyl)-2-propenoic acid methyl ester
PubChem Substance (SID):
85165377 116399 39382166PubChem Compound (CID):
5357283KEGG: Compound ID n/a
CAS Registry IDs: 2309-07-1
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
ChemSpider 4512663
ZINC ZINC01621053
DTP/NCI 74548
NIST 591679150
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.