InCHi String:
InChI=1S/C10H10O3/c1-13-10(12)7-4-8-2-5-9(11)6-3-8/h2-7,11H,1H3/b7-4+
canonical and isomeric SMILES: COC(=O)C=CC1=CC=C(C=C1)O
PUBCHEM iupac NAME: PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac SYSTEMATIC NAMEmethyl 3-(4-hydroxyphenyl)prop-2-enoate
PUBCHEM iupac TRADITIONAL NAME3-(4-hydroxyphenyl)acrylic acid methyl ester
PUBCHEM iupac CAS NAME3-(4-hydroxyphenyl)-2-propenoic acid methyl ester
PubChem Substance (SID):
85165373 669055 12033289PubChem Compound (CID):
92203KEGG: Compound ID n/a
CAS Registry IDs: 3943-97-3
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
ChemIDplus 003943973
EINECS 223-531-1
ZINC ZINC00153731
ChemDB 5758474
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.