InCHi String:
InChI=1/C12H14O4/c1-14-10-6-4-9(8-11(10)15-2)5-7-12(13)16-3/h4-8H,1-3H3/b7-5+
Canonical and Isomeric SMILES: COC1=C(C=C(C=C1)C=CC(=O)OC)OC
Beilsteinmethyl 3,4-dimethoxycinnamate
PubChem Substance (SID):
111678067PubChem Compound (CID): n/a
KEGG: Compound ID n/a
CAS Registry IDs: n/a
PDB Chemical Component n/a
NMR Lignin Database 70
Miscellaneous Databases and IDs: n/a
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
