InCHi String:
InChI=1S/C4H10O4/c5-1-3(7)4(8)2-6/h3-8H,1-2H2
isomeric and canonical SMILES: C(C(C(CO)O)O)O
IUPAC: IUPAC traditional: IUPAC cas: IUPAC openeye: IUPAC systematicbutane-1,2,3,4-tetrol
PubChem Substance (SID):
111677721 152169 3786PubChem Compound (CID):
8998KEGG: Compound ID
C00503CAS Registry IDs: 10030-58-7 149-32-6 188346-77-2
PDB Chemical Component
MRYMiscellaneous Databases and IDs:
CHEBI 17113 EINECS 205-737-3
CCRIS 7901
NSC 8099
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.