InCHi String:
InChI=1S/C10H16O/c1-7(2)8-4-5-10(3)9(6-8)11-10/h8-9H,1,4-6H2,2-3H3/t8-,9?,10?/m1/s1
canonical SMILES: CC(=C)C1CCC2(C(C1)O2)C
isomeric SMILES: CC(=C)[C@@H]1CCC2(C(C1)O2)C
PUBCHEM iupac NAME: PUBCHEM iupac SYSTEMATIC NAME(3R)-6-methyl-3-prop-1-en-2-yl-7-oxabicyclo[4.1.0]heptane
PUBCHEM iupac TRADITIONAL NAME: PUBCHEM iupac OPENEYE NAME(3R)-3-isopropenyl-6-methyl-7-oxabicyclo[4.1.0]heptane
PUBCHEM iupac CAS NAME(3R)-6-methyl-3-(1-methylethenyl)-7-oxabicyclo[4.1.0]heptane
PubChem Substance (SID):
144080964 14717785 74382162PubChem Compound (CID):
441245KEGG: Compound ID
C07271CAS Registry IDs: 1195-92-2
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
CAS 203719-54-4
MMCD cq_04288
Sigma-Aldrich 218324_ALDRICH
ChEBI CHEBI:35672 LipidMAPS LMPR0102090015
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.