InCHi String:
InChI=1/C20H18O6/c1-25-18-10-14(5-6-17(18)23)8-15(12-22)16-9-13(4-3-7-21)11-19(26-2)20(16)24/h3-12,23-24H,1-2H3/b4-3+,15-8-
Canonical and Isomeric SMILES: COC1=C(C=CC(=C1)C=C(C=O)C2=C(C(=CC(=C2)C=CC=O)OC)O)O
Beilsteinbeta-[5-(2-formylvinyl)-2-hydroxy-3-methoxyphenyl]coniferyl aldehyde
PubChem Substance (SID): n/a
PubChem Compound (CID): n/a
KEGG: Compound ID n/a
CAS Registry IDs: n/a
PDB Chemical Component n/a
NMR Lignin Database 3030
Miscellaneous Databases and IDs: n/a
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
