InCHi String:
InChI=1/C20H18O8/c1-26-15-9-12(4-7-18(21)22)3-6-14(15)28-17-11-13(5-8-19(23)24)10-16(27-2)20(17)25/h3-11,25H,1-2H3,(H,21,22)(H,23,24)/b7-4+,8-5+/f/h21,23H
Canonical and Isomeric SMILES: COC1=C(C=CC(=C1)C=CC(O)=O)OC2=CC(=CC(=C2O)OC)C=CC(O)=O
Beilstein4-O-5 dehydrodiferulic acid
PubChem Substance (SID): n/a
PubChem Compound (CID): n/a
KEGG: Compound ID n/a
CAS Registry IDs: n/a
PDB Chemical Component n/a
NMR Lignin Database 3003
Miscellaneous Databases and IDs: n/a
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
