InCHi String:
InChI=1/C14H18O5/c1-10(15)18-8-4-5-12-6-7-13(19-11(2)16)14(9-12)17-3/h6-7,9H,4-5,8H2,1-3H3
Canonical and Isomeric SMILES: CC(=O)OCCCC1=CC(=C(C=C1)OC(C)=O)OC
Beilsteindihydro-coniferyl alcohol diacetate
PubChem Substance (SID): n/a
PubChem Compound (CID): n/a
KEGG: Compound ID n/a
CAS Registry IDs: n/a
PDB Chemical Component n/a
NMR Lignin Database 280
Miscellaneous Databases and IDs: n/a
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
