InCHi String:
InChI=1/C27H28O9/c1-32-20-6-4-5-7-21(20)36-24(16-35-25(29)13-10-17-8-11-19(28)12-9-17)26(30)18-14-22(33-2)27(31)23(15-18)34-3/h4-15,24,26,28,30-31H,16H2,1-3H3/b13-10+/t24-,26+/m1/s1
Canonical and Isomeric SMILES: COC1=CC=CC=C1O[C@H](COC(C=CC2=CC=C(C=C2)O)=O)[C@H](C3=CC(=C(C(=C3)OC)O)OC)O
BeilsteinG-p-coumaroylated syringylglycerol-?04-guaiacyl ether
PubChem Substance (SID): n/a
PubChem Compound (CID): n/a
KEGG: Compound ID n/a
CAS Registry IDs: n/a
PDB Chemical Component n/a
NMR Lignin Database 2078
Miscellaneous Databases and IDs: n/a
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
