InCHi String:
InChI=1/C33H34O12/c1-20(34)42-25-14-11-23(12-15-25)13-16-31(37)41-19-30(45-27-10-8-7-9-26(27)38-4)32(43-21(2)35)24-17-28(39-5)33(44-22(3)36)29(18-24)40-6/h7-18,30,32H,19H2,1-6H3/b16-13+/t30-,32+/m1/s1
Canonical and Isomeric SMILES: CC(=O)OC1=CC=C(C=C1)C=CC(=O)OC[C@H]([C@H](C2=CC(=C(C(=C2)OC)OC(C)=O)OC)OC(C)=O)OC3=CC=CC=C3OC
BeilsteinG-p-coumaroylated syringylglycerol-B04-guiacol ether (Ac?d)
PubChem Substance (SID): n/a
PubChem Compound (CID): n/a
KEGG: Compound ID n/a
CAS Registry IDs: n/a
PDB Chemical Component n/a
NMR Lignin Database 2077
Miscellaneous Databases and IDs: n/a
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
