InCHi String:
InChI=1/C19H22O5/c1-23-18-13-15(6-10-17(18)21)3-2-12-24-19(22)11-7-14-4-8-16(20)9-5-14/h4-6,8-10,13,20-21H,2-3,7,11-12H2,1H3
Canonical and Isomeric SMILES: COC1=C(C=CC(=C1)CCCOC(CCC2=CC=C(C=C2)O)=O)O
BeilsteinDihydroconiferyl 4-hydroxydihydrocinnamate
PubChem Substance (SID): n/a
PubChem Compound (CID): n/a
KEGG: Compound ID n/a
CAS Registry IDs: n/a
PDB Chemical Component n/a
NMR Lignin Database 2063
Miscellaneous Databases and IDs: n/a
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
